CAS 89011-16-5
:2-Hydroxy-3,4,5-triiodobenzoic acid hydrazide
Description:
2-Hydroxy-3,4,5-triiodobenzoic acid hydrazide, with the CAS number 89011-16-5, is a chemical compound characterized by the presence of a hydrazide functional group attached to a triiodinated benzoic acid derivative. This compound features three iodine atoms substituted on the benzene ring, which significantly influences its chemical properties, including increased molecular weight and potential biological activity. The hydroxyl group (-OH) contributes to its solubility in polar solvents and may enhance its reactivity in various chemical reactions. The hydrazide moiety can participate in condensation reactions, making it useful in the synthesis of other organic compounds. Additionally, the presence of iodine atoms may impart unique properties, such as enhanced X-ray contrast, which is relevant in medical imaging applications. Overall, this compound's structure suggests potential utility in pharmaceuticals, particularly in areas related to imaging or as a precursor for further chemical modifications. However, specific applications and biological activities would require further investigation and validation through experimental studies.
Formula:C7H5I3N2O2
InChI:InChI=1S/C7H5I3N2O2/c8-3-1-2(7(14)12-11)6(13)5(10)4(3)9/h1,13H,11H2,(H,12,14)
InChI key:InChIKey=KBLBLFZSYOELJA-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C(O)C(I)=C(I)C(I)=C1
Synonyms:- Benzoic acid, 2-hydroxy-3,4,5-triiodo-, hydrazide
- 2-Hydroxy-3,4,5-triiodobenzoic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
