CAS 89012-56-6

2-Hydroxyethyl 1,3-benzodioxole-5-carboxylate

Description:

2-Hydroxyethyl 1,3-benzodioxole-5-carboxylate, with the CAS number 89012-56-6, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a carboxylate functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents, which makes it useful in various chemical applications. The presence of the hydroxyethyl group enhances its reactivity, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitutions. Additionally, the benzodioxole structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Its properties may include moderate to low toxicity, but specific safety data should be consulted for handling and usage. Overall, 2-Hydroxyethyl 1,3-benzodioxole-5-carboxylate is a versatile compound with applications in organic synthesis and potentially in pharmaceuticals.

Formula: C₁₀H₁₀O₅

InChI: InChI=1S/C10H10O5/c11-3-4-13-10(12)7-1-2-8-9(5-7)15-6-14-8/h1-2,5,11H,3-4,6H2

InChI key: InChIKey=UQSADMIICVKBRA-UHFFFAOYSA-N

SMILES: C(OCCO)(=O)C=1C=C2C(=CC1)OCO2

Synonyms:

• 2-Hydroxyethyl 2H-1,3-benzodioxole-5-carboxylate
• 2-Hydroxyethyl 1,3-benzodioxole-5-carboxylate
• 1,3-Benzodioxole-5-carboxylic acid, 2-hydroxyethyl ester

1,3-Benzodioxole-5-carboxylic acid, 2-hydroxyethyl ester

CAS: 89012-56-6

Formula: C₁₀H₁₀O₅

Molecular weight: 210.1834

Ref: IN-DA0042UO