CAS 89013-44-5
:N-[4-(4-Amino-2-chlorophenoxy)phenyl]acetamide
Description:
N-[4-(4-Amino-2-chlorophenoxy)phenyl]acetamide, with the CAS number 89013-44-5, is an organic compound characterized by its amide functional group and a complex aromatic structure. This compound features a phenyl ring substituted with an amino group and a chlorophenoxy moiety, which contributes to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The chlorophenoxy group can influence the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the acetamide group indicates that it may exhibit properties typical of amides, such as stability under various conditions. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. Overall, N-[4-(4-Amino-2-chlorophenoxy)phenyl]acetamide represents a class of compounds that may hold significance in drug discovery and development.
Formula:C14H13ClN2O2
InChI:InChI=1S/C14H13ClN2O2/c1-9(18)17-11-3-5-12(6-4-11)19-14-7-2-10(16)8-13(14)15/h2-8H,16H2,1H3,(H,17,18)
InChI key:InChIKey=WSXHLQVCISVWBA-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(N)C=C1)C2=CC=C(NC(C)=O)C=C2
Synonyms:- Acetamide, N-[4-(4-amino-2-chlorophenoxy)phenyl]-
- N-[4-(4-Amino-2-chlorophenoxy)phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
