CAS 89021-98-7
:N-(2-methyl-3-sulfanylpropanoyl)glycine
Description:
N-(2-methyl-3-sulfanylpropanoyl)glycine, also known by its CAS number 89021-98-7, is an amino acid derivative characterized by the presence of a glycine backbone with a propanoyl group that features a methyl and a sulfanyl (thiol) substituent. This compound exhibits properties typical of amino acids, including the ability to participate in peptide bond formation, making it relevant in biochemical contexts. The sulfanyl group introduces unique reactivity, potentially influencing the compound's behavior in biological systems, such as its role in redox reactions or as a nucleophile. The presence of the methyl group may affect steric hindrance and solubility, impacting its interactions with other biomolecules. Additionally, the compound's structure suggests it may have applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, N-(2-methyl-3-sulfanylpropanoyl)glycine represents a fascinating example of modified amino acids with potential implications in both synthetic and biological chemistry.
Formula:C6H11NO3S
InChI:InChI=1/C6H11NO3S/c1-4(3-11)6(10)7-2-5(8)9/h4,11H,2-3H2,1H3,(H,7,10)(H,8,9)
SMILES:CC(CS)C(=NCC(=O)O)O
Synonyms:- glycine, N-(3-mercapto-2-methyl-1-oxopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(3-Mercapto-2-methylpropanoyl)glycine
CAS:Controlled ProductApplications N-(3-Mercapto-2-methylpropanoyl)glycine (cas# 89021-98-7) is a compound useful in organic synthesis.
Formula:C6H11NO3SColor and Shape:NeatMolecular weight:177.22
