CAS 89026-22-2
:Acetic acid, (2-naphthalenyloxy)-, compd. with 2,2′,2′′-nitrilotris[ethanol] (1:1)
Description:
The chemical substance known as "Acetic acid, (2-naphthalenyloxy)-, compd. with 2,2′,2′′-nitrilotris[ethanol] (1:1)" and identified by the CAS number 89026-22-2 is a complex organic compound that features both an acetic acid moiety and a naphthalenyloxy group. This compound is characterized by its potential applications in various fields, including pharmaceuticals and materials science, due to its unique structural properties. The presence of the naphthalenyloxy group suggests that it may exhibit aromatic characteristics, which can influence its reactivity and interaction with other substances. Additionally, the inclusion of 2,2′,2′′-nitrilotris[ethanol] indicates that the compound may possess multiple hydroxyl groups, contributing to its solubility in polar solvents and potentially enhancing its ability to form hydrogen bonds. Overall, this compound's unique combination of functional groups may impart specific biological or chemical activities, making it of interest for further research and application development.
Formula:C12H10O3·C6H15NO3
InChI:InChI=1S/C12H10O3.C6H15NO3/c13-12(14)8-15-11-6-5-9-3-1-2-4-10(9)7-11;8-4-1-7(2-5-9)3-6-10/h1-7H,8H2,(H,13,14);8-10H,1-6H2
InChI key:InChIKey=ZWGDPPZBIBCVLL-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC2=C(C=C1)C=CC=C2.N(CCO)(CCO)CCO
Synonyms:- 2-Naphthoxyacetic acid triethanolamine salt
- Ethanol, 2,2′,2′′-nitrilotris-, (2-naphthalenyloxy)acetate (salt)
- Acetic acid, (2-naphthalenyloxy)-, compd. with 2,2′,2′′-nitrilotris[ethanol] (1:1)
- Betoxon Super
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
