
CAS 89026-60-8
:4-Nonyl-1-piperazinecarboxamide
Description:
4-Nonyl-1-piperazinecarboxamide, with the CAS number 89026-60-8, is a chemical compound characterized by its piperazine structure, which includes a nonyl group attached to the nitrogen atom of the piperazine ring. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential interactions with biological systems due to its amine and carbonyl functional groups. The nonyl group contributes to its hydrophobic characteristics, influencing its behavior in various environments, including its potential applications in pharmaceuticals or as a surfactant. The presence of the piperazine moiety may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, 4-Nonyl-1-piperazinecarboxamide is a versatile compound with potential applications in various fields, including drug development and materials science.
Formula:C14H29N3O
InChI:InChI=1S/C14H29N3O/c1-2-3-4-5-6-7-8-9-16-10-12-17(13-11-16)14(15)18/h2-13H2,1H3,(H2,15,18)
InChI key:InChIKey=MGCSKXNZRCRVJG-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)N1CCN(C(N)=O)CC1
Synonyms:- 4-Nonyl-1-piperazinecarboxamide
- 1-Piperazinecarboxamide, 4-nonyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
