CAS 89026-62-0
:4-(4-Methylphenyl)-1-piperazinecarbonitrile
Description:
4-(4-Methylphenyl)-1-piperazinecarbonitrile, with the CAS number 89026-62-0, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered cyclic amine, substituted with a cyano group (-C≡N) and a para-methylphenyl group. This compound is typically characterized by its molecular structure, which contributes to its potential biological activity. It may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific conditions. The presence of the cyano group can influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, compounds of this type may be investigated for their pharmacological properties, including potential effects on the central nervous system or other therapeutic applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H15N3
InChI:InChI=1S/C12H15N3/c1-11-2-4-12(5-3-11)15-8-6-14(10-13)7-9-15/h2-5H,6-9H2,1H3
InChI key:InChIKey=ZEHULZVRMZYGBA-UHFFFAOYSA-N
SMILES:C(#N)N1CCN(CC1)C2=CC=C(C)C=C2
Synonyms:- 4-(4-Methylphenyl)-1-piperazinecarbonitrile
- 1-Piperazinecarbonitrile, 4-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
