CymitQuimica logo

CAS 89026-81-3

:

6-Bromo-N-(1-methylethyl)-2-pyridinamine

Description:
6-Bromo-N-(1-methylethyl)-2-pyridinamine, with the CAS number 89026-81-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The N-(1-methylethyl) substituent indicates that there is an isopropyl group attached to the nitrogen atom, which can influence the compound's solubility and steric properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of the functional groups present. Additionally, the bromine substituent can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in synthetic chemistry. Overall, 6-Bromo-N-(1-methylethyl)-2-pyridinamine is a compound with potential utility in various chemical and pharmaceutical applications.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c1-6(2)10-8-5-3-4-7(9)11-8/h3-6H,1-2H3,(H,10,11)
InChI key:InChIKey=FZACLMVHJVRFML-UHFFFAOYSA-N
SMILES:N(C(C)C)C=1N=C(Br)C=CC1
Synonyms:
  • 6-Bromo-N-(1-methylethyl)-2-pyridinamine
  • 2-Pyridinamine, 6-bromo-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.