CymitQuimica logo

CAS 890324-00-2

:

N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine

Description:
N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and an allylic amine functional group. The presence of the 3-phenyl-1,2,4-oxadiazol-5-yl moiety contributes to its potential as a bioactive molecule, often associated with various biological activities, including antimicrobial and anticancer properties. The prop-2-en-1-amine part of the molecule indicates that it has an unsaturated amine, which can participate in various chemical reactions, such as nucleophilic additions or polymerization processes. This compound may exhibit moderate to high solubility in organic solvents, depending on the specific substituents and their interactions. Its molecular structure suggests potential applications in medicinal chemistry and material science, particularly in the development of new pharmaceuticals or functional materials. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in detail for practical applications.
Formula:C12H13N3O
InChI:InChI=1/C12H13N3O/c1-2-8-13-9-11-14-12(15-16-11)10-6-4-3-5-7-10/h2-7,13H,1,8-9H2
SMILES:C=CCNCc1nc(c2ccccc2)no1
Synonyms:
  • Allyl-(3-phenyl-[1,2,4]oxadiazol-5-ylmethyl)-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.