CAS 890324-13-7

1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

Description:

1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine, with the CAS number 890324-13-7, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and an amine functional group. The presence of the 3-methylphenyl substituent contributes to its aromatic properties, which can influence its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its oxadiazole moiety is known for potential applications in pharmaceuticals and materials science due to its electronic properties. The amine group can participate in hydrogen bonding, making the compound potentially useful in various chemical reactions, including those involving nucleophilic substitution. Additionally, the compound's specific interactions with biological systems may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, the characteristics of this compound suggest it may have diverse applications in both research and industry.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1/C10H11N3O/c1-7-3-2-4-8(5-7)10-12-9(6-11)14-13-10/h2-5H,6,11H2,1H3

SMILES: Cc1cccc(c1)c1nc(CN)on1

Synonyms:

• 1,2,4-Oxadiazole-5-Methanamine, 3-(3-Methylphenyl)-

[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]methylamine hydrochloride

CAS: 890324-13-7

Formula: C₁₀H₁₂ClN₃O

Molecular weight: 225.6748

Ref: IN-DA0043YF

1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

CAS: 890324-13-7

Formula: C₁₀H₁₁N₃O

Purity: 95.0%

Molecular weight: 189.218

Ref: 10-F315691