CAS 890324-18-2

N-methyl-1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

Description:

N-methyl-1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine, with the CAS number 890324-18-2, is a chemical compound characterized by its unique structure that includes a methanamine group and an oxadiazole ring. The presence of the 3-methylphenyl substituent contributes to its aromatic properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity due to the oxadiazole moiety, which is often associated with various pharmacological effects. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. As with many organic compounds, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its chemical behavior and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1/C11H13N3O/c1-8-4-3-5-9(6-8)11-13-10(7-12-2)15-14-11/h3-6,12H,7H2,1-2H3

SMILES: Cc1cccc(c1)c1nc(CNC)on1

Synonyms:

• 1,2,4-oxadiazole-5-methanamine, N-methyl-3-(3-methylphenyl)-
• Methyl-(3-m-tolyl-[1,2,4]oxadiazol-5-ylmethyl)-amine

N-methyl-1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine hydrochloride

CAS: 890324-18-2

Formula: C₁₁H₁₃N₃O

Molecular weight: 203.2404

Ref: IN-DA0042BV