CAS 890324-23-9
:N-Ethyl-3-(3-methylphenyl)-1,2,4-oxadiazole-5-methanamine
Description:
N-Ethyl-3-(3-methylphenyl)-1,2,4-oxadiazole-5-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the ethyl group and the 3-methylphenyl substituent enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit properties typical of oxadiazoles, such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. The methanamine functional group suggests potential for further chemical reactivity, possibly allowing for derivatization or interaction with various biological targets. Its molecular structure indicates that it may participate in hydrogen bonding and other intermolecular interactions, which could be relevant in pharmacological contexts. As with many synthetic organic compounds, safety and handling precautions should be observed, and its stability under various conditions should be assessed for practical applications. Further research would be essential to fully elucidate its properties and potential uses in medicinal chemistry or other fields.
Formula:C12H15N3O
InChI:InChI=1S/C12H15N3O/c1-3-13-8-11-14-12(15-16-11)10-6-4-5-9(2)7-10/h4-7,13H,3,8H2,1-2H3
InChI key:InChIKey=LIICIUSGNVIRCN-UHFFFAOYSA-N
SMILES:C(NCC)C1=NC(=NO1)C2=CC(C)=CC=C2
Synonyms:- 1,2,4-oxadiazole-5-methanamine, N-ethyl-3-(3-methylphenyl)-
- Ethyl-(3-m-tolyl-[1,2,4]oxadiazol-5-ylmethyl)-amine
- N-Ethyl-3-(3-methylphenyl)-1,2,4-oxadiazole-5-methanamine
- N-{[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}ethanamine
- N-([3-(3-METHYLPHENYL)-1,2,4-OXADIAZOL-5-YL]METHYL)ETHANAMINE HYDROCHLORIDE
- N-{[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}ethanamine hydrochloride(SALTDATA: FREE)
- N-((3-(m-tolyl)-1,2,4-oxadiazol-5-yl)methyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.