CAS 890324-74-0

1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

Description:

1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine, with the CAS number 890324-74-0, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and an amine functional group. The presence of the 4-methylphenyl group contributes to its aromatic properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its oxadiazole moiety is known for its role in various pharmacological applications, including antimicrobial and anti-inflammatory properties. The amine group can participate in hydrogen bonding, which may enhance its interactions with biological targets. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the oxadiazole, affecting its potential applications in research and industry. Overall, this compound represents a class of heterocyclic compounds that are valuable in the exploration of new therapeutic agents.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1/C10H11N3O/c1-7-2-4-8(5-3-7)10-12-9(6-11)14-13-10/h2-5H,6,11H2,1H3

SMILES: Cc1ccc(cc1)c1nc(CN)on1

Synonyms:

• 1,2,4-Oxadiazole-5-Methanamine, 3-(4-Methylphenyl)-

[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

CAS: 890324-74-0

Formula: C₁₀H₁₁N₃O

Purity: 95%

Molecular weight: 189.2138

Ref: IN-DA0043YE

[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

CAS: 890324-74-0

[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine

Purity: 98%

Molecular weight: 189.21g/mol

Ref: 54-OR960244

{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}amine

CAS: 890324-74-0

Formula: C₁₀H₁₁N₃O

Purity: 95%

Molecular weight: 189.218

Ref: 10-F309262