CymitQuimica logo

CAS 890324-84-2

:

N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}ethanamine

Description:
N-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}ethanamine, with the CAS number 890324-84-2, is a chemical compound characterized by its unique structure that includes an oxadiazole ring, which is known for its potential biological activity. The presence of the 4-methylphenyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The ethanamine moiety suggests that the compound may exhibit basic properties, allowing it to participate in various chemical reactions, including those involving protonation. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to pharmacological activities. Additionally, the oxadiazole ring is often associated with compounds that have antimicrobial, anti-inflammatory, or anticancer properties. Overall, the characteristics of this compound make it a subject of interest for further research in drug development and material science.
Formula:C12H15N3O
InChI:InChI=1/C12H15N3O/c1-3-13-8-11-14-12(15-16-11)10-6-4-9(2)5-7-10/h4-7,13H,3,8H2,1-2H3
SMILES:CCNCc1nc(c2ccc(C)cc2)no1
Synonyms:
  • 1,2,4-oxadiazole-5-methanamine, N-ethyl-3-(4-methylphenyl)-
  • Ethyl-(3-p-tolyl-[1,2,4]oxadiazol-5-ylmethyl)-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.