CAS 890325-34-5

1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine

Description:

1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine, with the CAS number 890325-34-5, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and a methanamine moiety. The presence of the 4-methoxyphenyl group contributes to its potential aromatic properties, while the oxadiazole ring is known for its stability and ability to participate in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to pharmacological effects. Additionally, the presence of the N-methyl group may influence its lipophilicity and solubility, affecting its bioavailability. Overall, this compound's characteristics, including its functional groups and structural features, position it as a candidate for further research in various chemical and biological applications.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1/C11H13N3O2/c1-12-7-10-13-11(14-16-10)8-3-5-9(15-2)6-4-8/h3-6,12H,7H2,1-2H3

SMILES: CNCc1nc(c2ccc(cc2)OC)no1

Synonyms:

• 1,2,4-oxadiazole-5-methanamine, 3-(4-methoxyphenyl)-N-methyl-

1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylmethanamine

CAS: 890325-34-5

Formula: C₁₁H₁₃N₃O₂

Molecular weight: 219.2398

Ref: IN-DA0042BR