CAS 89033-27-2

2-Oxo-4-oxazolidinecarboxylic acid

Description:

2-Oxo-4-oxazolidinecarboxylic acid, with the CAS number 89033-27-2, is a heterocyclic compound characterized by its oxazolidine ring structure, which incorporates both an oxo group and a carboxylic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid group. The oxazolidine ring contributes to its stability and may influence its reactivity, making it of interest in various chemical syntheses and applications. It may also exhibit biological activity, which could be relevant in pharmaceutical contexts. The presence of both the carbonyl and carboxylic acid functionalities suggests potential for hydrogen bonding, which can affect its interactions with other molecules. Overall, 2-Oxo-4-oxazolidinecarboxylic acid is a compound of interest in organic chemistry and medicinal chemistry, with potential applications in drug development and synthesis.

Formula: C₄H₅NO₄

InChI: InChI=1S/C4H5NO4/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)

InChI key: InChIKey=XMFFFMBLTDERID-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(=O)OC1

2-Oxo-1,3-oxazolidine-4-carboxylic acid

CAS: 89033-27-2

2-Oxo-1,3-oxazolidine-4-carboxylic acid is a chemical compound that belongs to the group of organic solvents. It is a racemic mixture of two stereoisomers that are mirror images of one another. This compound has been shown to have antifungal properties, inhibiting the growth of Talaromyces and Curvularia. 2-Oxo-1,3-oxazolidine-4-carboxylic acid has also been shown to be effective against Achromobacter and Racemizea species and to inhibit the growth of Pseudomonas aeruginosa. The conformation of this molecule is an acidic pseudopeptide with a sulfur atom at C2.

Formula: C₄H₅NO₄

Purity: Min. 95%

Molecular weight: 131.09 g/mol

Ref: 3D-PDA03327