CAS 89033-31-8
:5-Isothiazolecarboxylic acid, hydrazide
Description:
5-Isothiazolecarboxylic acid, hydrazide is a chemical compound characterized by its isothiazole ring structure, which contributes to its unique reactivity and properties. This compound typically exhibits a hydrazide functional group, which is known for its ability to form hydrazones and undergo various chemical transformations. It is often utilized in organic synthesis and medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of both the isothiazole and hydrazide functionalities allows for diverse interactions with biological targets, making it a subject of interest in drug development. Additionally, this compound may exhibit solubility in polar solvents, which can influence its application in various chemical reactions. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use. Overall, 5-Isothiazolecarboxylic acid, hydrazide represents a versatile building block in synthetic chemistry and pharmaceutical research.
Formula:C4H5N3OS
InChI:InChI=1S/C4H5N3OS/c5-7-4(8)3-1-2-6-9-3/h1-2H,5H2,(H,7,8)
InChI key:InChIKey=RVGMSZPCMWBCLD-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC=NS1
Synonyms:- 5-Isothiazolecarboxylic acid, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
