CymitQuimica logo

CAS 89033-45-4

:

2,5-dioxoimidazolidine-4-carboxamide

Description:
2,5-Dioxoimidazolidine-4-carboxamide, identified by its CAS number 89033-45-4, is a heterocyclic organic compound featuring a five-membered imidazolidine ring. This compound is characterized by the presence of two carbonyl (keto) groups at the 2 and 5 positions and an amide functional group at the 4 position. The structure contributes to its potential reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and the ability to participate in various chemical reactions, including nucleophilic attacks due to the electrophilic nature of the carbonyl groups. Additionally, the presence of the imidazolidine ring may impart specific interactions with biological macromolecules, making it of interest in medicinal chemistry and drug design. Overall, 2,5-dioxoimidazolidine-4-carboxamide is a compound that may serve as a valuable building block in synthetic organic chemistry and pharmaceutical applications.
Formula:C4H5N3O3
InChI:InChI=1/C4H5N3O3/c5-2(8)1-3(9)7-4(10)6-1/h1H,(H2,5,8)(H2,6,7,9,10)
SMILES:C1(C(=N)O)C(=NC(=N1)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.