CAS 89033-89-6

5,6-dichloropyrimidine-2,4-diamine

Description:

5,6-Dichloropyrimidine-2,4-diamine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two chlorine substituents at the 5 and 6 positions and amino groups at the 2 and 4 positions. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of amino groups that can engage in hydrogen bonding. Its molecular structure contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of chlorine atoms enhances its electrophilic character, while the amino groups can act as nucleophiles. This compound is of interest in medicinal chemistry and agricultural applications, particularly in the development of pharmaceuticals and agrochemicals. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.

Formula: C₄H₄Cl₂N₄

InChI: InChI=1/C4H4Cl2N4/c5-1-2(6)9-4(8)10-3(1)7/h(H4,7,8,9,10)

SMILES: c1(c(Cl)[nH]c(=N)[nH]c1=N)Cl

5,6-Dichloropyrimidine-2,4-diamine

CAS: 89033-89-6

Formula: C₄H₄Cl₂N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.0074

Ref: IN-DA00H27Y

2,4-Diamine-5,6-Dichloropyrimidine

CAS: 89033-89-6

Formula: C₄H₄Cl₂N₄

Color and Shape: White To Off-White Solid

Molecular weight: 179.00

Ref: 4Z-P-212012

5,6-Dichloropyrimidine-2,4-diamine

CAS: 89033-89-6

5,6-Dichloropyrimidine-2,4-diamine

Purity: 98%

Ref: 54-OR1040860

5,6-Dichloro-2,4-pyrimidinediamine

CAS: 89033-89-6

5,6-Dichloro-2,4-pyrimidinediamine (1) is a synthetic intermediate for the synthesis of pyridazine and pyridine. 1 has shown antibacterial activity against Gram-positive bacteria such as Staphylococcus aureus and Streptococcus pneumoniae. It also has been shown to be effective against Gram-negative bacteria such as Escherichia coli, Proteus mirabilis, and Klebsiella pneumoniae. 5,6-Dichloro-2,4-pyrimidinediamine is an imidazole compound that can be used in the synthesis of new drugs with antiinflammatory properties. The functional groups on this molecule are highlighted in red and blue respectively. This molecule can connect to other molecules through its two amide bonds or n -oxide group.

Formula: C₄H₄Cl₂N₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 179.01 g/mol

Ref: 3D-FD166146

5,6-Dichloropyrimidine-2,4-diamine

CAS: 89033-89-6

Purity: 98%

Molecular weight: 179

Ref: 10-F612672

5,6-Dichloro-2,4-Pyrimidinediamine

Controlled Product

CAS: 89033-89-6

Formula: C₄H₄Cl₂N₄

Color and Shape: Neat

Molecular weight: 179.007

Ref: TR-D437380

5,6-dichloropyrimidine-2,4-diamine

CAS: 89033-89-6

Formula: C₄H₄Cl₂N₄

Molecular weight: 179.00

Ref: ST-EA-CP-M106007