CAS 89040-05-1
:2-[(2-fluorobenzyl)sulfanyl]ethanol
Description:
2-[(2-Fluorobenzyl)sulfanyl]ethanol is an organic compound characterized by the presence of a sulfanyl (thioether) functional group and an alcohol group. The molecular structure features a benzyl group substituted with a fluorine atom at the ortho position relative to the sulfur atom, which is linked to an ethanol moiety. This compound is likely to exhibit moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in polar solvents like water. The presence of the fluorine atom may impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological systems. Additionally, the sulfanyl group can participate in various chemical reactions, such as nucleophilic substitutions or oxidation processes. Overall, 2-[(2-fluorobenzyl)sulfanyl]ethanol may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or industrial uses would require further investigation.
Formula:C9H11FOS
InChI:InChI=1/C9H11FOS/c10-9-4-2-1-3-8(9)7-12-6-5-11/h1-4,11H,5-7H2
SMILES:c1ccc(c(c1)CSCCO)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
