CAS 890409-86-6

3-(Methylsulfonyl)-2,5-dioxo-1-pyrrolidinyl 4-[(5-nitro-2-pyridinyl)dithio]butanoate

Description:

3-(Methylsulfonyl)-2,5-dioxo-1-pyrrolidinyl 4-[(5-nitro-2-pyridinyl)dithio]butanoate, with CAS number 890409-86-6, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and various functional groups such as a methylsulfonyl moiety and a nitro-substituted pyridine. This compound is typically classified as a dithioester derivative, indicating the presence of sulfur atoms in its structure, which can impart unique reactivity and properties. The presence of the dioxo group suggests potential for chelation or coordination with metal ions, while the nitro group may contribute to its electronic properties and reactivity. Such compounds are often investigated for their biological activity, including potential pharmaceutical applications, due to their ability to interact with biological targets. Additionally, the presence of multiple functional groups allows for diverse chemical reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. Safety and handling precautions should be observed, as with many synthetic organic compounds, due to potential toxicity or reactivity.

Formula: C₁₄H₁₅N₃O₈S₃

InChI: InChI=1S/C14H15N3O8S3/c1-28(23,24)10-7-12(18)16(14(10)20)25-13(19)3-2-6-26-27-11-5-4-9(8-15-11)17(21)22/h4-5,8,10H,2-3,6-7H2,1H3

InChI key: InChIKey=RIXGLVALRPRFJK-UHFFFAOYSA-N

SMILES: O(C(CCCSSC1=CC=C(N(=O)=O)C=N1)=O)N2C(=O)C(S(C)(=O)=O)CC2=O

Synonyms:

• Butanoic acid, 4-[(5-nitro-2-pyridinyl)dithio]-, 3-(methylsulfonyl)-2,5-dioxo-1-pyrrolidinyl ester
• 2,5-Pyrrolidinedione, 3-(methylsulfonyl)-1-[4-[(5-nitro-2-pyridinyl)dithio]-1-oxobutoxy]-
• 3-(Methylsulfonyl)-2,5-dioxo-1-pyrrolidinyl 4-[(5-nitro-2-pyridinyl)dithio]butanoate

SNPB-sulfo-Me

CAS: 890409-86-6

SNPB-sulfo-Me is a cleavable linker that is used for making antibody-drug conjugate (ADC).

Formula: C₁₄H₁₅N₃O₈S₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 449.48

Ref: TM-T18698

3-(Methylsulfonyl)-2,5-dioxopyrrolidin-1-yl 4-((5-nitropyridin-2-yl)disulfanyl)butanoate

CAS: 890409-86-6

3-(Methylsulfonyl)-2,5-dioxopyrrolidin-1-yl 4-((5-nitropyridin-2-yl)disulfanyl)butanoate is a sophisticated biochemical compound used primarily in research settings. This compound, derived from synthetic sources, functions through its reactive disulfide linkage, enabling the modification of thiol groups in proteins or other biomolecules. This reactivity is crucial for applications involving targeted chemical modifications, serving as a useful tool in the investigation of biochemical pathways and interactions.

Formula: C₁₄H₁₅N₃O₈S₃

Purity: Min. 95%

Molecular weight: 449.5 g/mol

Ref: 3D-QKB40986