CymitQuimica logo

CAS 89043-32-3

:

Silane, (4-bromobutoxy)(1,1-dimethylethyl)dimethyl-

Description:
Silane, (4-bromobutoxy)(1,1-dimethylethyl)dimethyl- is an organosilicon compound characterized by the presence of a silane group attached to various organic substituents. This compound features a branched alkyl group, specifically a tert-butyl group, along with a bromobutoxy moiety, which contributes to its unique chemical properties. The presence of bromine in the structure may impart reactivity, particularly in nucleophilic substitution reactions. Silanes generally exhibit properties such as low volatility and the ability to form siloxane bonds, making them useful in various applications, including surface modification, adhesion, and as intermediates in organic synthesis. The compound's molecular structure suggests potential applications in materials science and organic chemistry, particularly in the development of functionalized surfaces or as a coupling agent in polymer chemistry. Additionally, the presence of multiple functional groups may influence its solubility and reactivity in different solvents, making it a versatile compound in chemical research and industrial applications.
Formula:C10H23BrOSi
InChI:InChI=1S/C10H23BrOSi/c1-10(2,3)13(4,5)12-9-7-6-8-11/h6-9H2,1-5H3
InChI key:YORLKVKBZRVNMZ-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCCCCBr
Synonyms:
  • (4-Bromobutoxy)(tert-butyl)dimethylsilane
Found 5 products.