CAS 89044-52-0
:2,3-Dihydro-2,6,7-trimethyl-1H-inden-1-one
Description:
2,3-Dihydro-2,6,7-trimethyl-1H-inden-1-one, with the CAS number 89044-52-0, is an organic compound characterized by its bicyclic structure, which includes an indene framework. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of three methyl groups at the 2, 6, and 7 positions of the indene ring enhances its hydrophobic character and may influence its physical properties, such as boiling point and solubility. Typically, compounds like this can exhibit interesting aromatic properties and may be involved in various chemical reactions, including electrophilic substitutions. Its structural features suggest potential uses in the fragrance industry or as a building block in the synthesis of more complex organic molecules. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation and should be referenced from safety data sheets or chemical databases for comprehensive safety and handling information.
Formula:C12H14O
InChI:InChI=1S/C12H14O/c1-7-4-5-10-6-8(2)12(13)11(10)9(7)3/h4-5,8H,6H2,1-3H3
InChI key:InChIKey=UYOMEWIDYJRAQA-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC1C)=CC=C(C)C2C
Synonyms:- 2,6,7-Trimethyl-2,3-dihydro-1H-inden-1-one
- 2,6,7-Trimethylindan-1-one
- 1H-Inden-1-one, 2,3-dihydro-2,6,7-trimethyl-
- 2,3-Dihydro-2,6,7-trimethyl-1H-inden-1-one
- 2,6,7-Trimethyl-2,3-dihydroinden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
