CAS 89059-46-1
:2,3,7,8-Tetrachlorodibenzofuran-13C12
Description:
2,3,7,8-Tetrachlorodibenzofuran (TCDF) is a chlorinated aromatic compound that belongs to the dibenzofuran family, characterized by the presence of four chlorine atoms at the 2, 3, 7, and 8 positions on the dibenzofuran structure. This compound is known for its environmental persistence and potential toxicity, particularly as a dioxin-like compound. TCDF is often formed as a byproduct in various industrial processes, including the production of herbicides and the combustion of organic materials. Its chemical structure contributes to its lipophilicity, allowing it to bioaccumulate in the food chain, which raises concerns regarding its impact on human health and ecosystems. Toxicological studies have indicated that TCDF can disrupt endocrine functions and may be associated with various adverse health effects, including carcinogenicity. Due to its hazardous nature, TCDF is subject to regulatory scrutiny, and efforts are made to monitor and mitigate its release into the environment.
Formula:C12H4Cl4O
InChI:InChI=1S/C12H4Cl4O/c13-7-1-5-6-2-8(14)10(16)4-12(6)17-11(5)3-9(7)15/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1
InChI key:InChIKey=KSMVNVHUTQZITP-WCGVKTIYSA-N
SMILES:Cl[13C]=1[13CH]=[13C]2[13C]=3[13C](O[13C]2=[13CH][13C]1Cl)=[13CH][13C](Cl)=[13C](Cl)[13CH]3
Synonyms:- Dibenzofuran-13C12, 2,3,7,8-tetrachloro-
- 2,3,7,8-TCDF-13C12
- 2,3,7,8-Tetrachlorodibenzofuran-13C12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3,7,8-Tetrachlorodibenzofuran-13C12
CAS:Controlled ProductFormula:C12H4Cl4OColor and Shape:NeatMolecular weight:317.88

