CAS 890591-64-7
:3-(3-methoxyphenyl)-1H-pyrazole-5-carboxylic acid
Description:
3-(3-Methoxyphenyl)-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 3-methoxyphenyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly serving as a scaffold for drug development. Additionally, the compound's solubility and stability can be influenced by the methoxy group, which can affect its overall behavior in biological systems. As with many pyrazole derivatives, it may also participate in hydrogen bonding and other intermolecular interactions, which are crucial for its function in biological contexts. Overall, this compound represents a class of molecules that can be explored for therapeutic applications, particularly in areas such as anti-inflammatory or analgesic research.
Formula:C11H10N2O3
InChI:InChI=1/C11H10N2O3/c1-16-8-4-2-3-7(5-8)9-6-10(11(14)15)13-12-9/h2-6H,1H3,(H,12,13)(H,14,15)
SMILES:COc1cccc(c1)c1cc(C(=O)O)n[nH]1
Synonyms:- 1H-Pyrazole-3-carboxylic acid, 5-(3-methoxyphenyl)-
- 1H-pyrazole-5-carboxylic acid, 3-(3-methoxyphenyl)-
- 5-(3-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid
- 5-(3-Methoxy-Phenyl)-2H-Pyrazole-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
