CAS 890621-13-3
:3-(2-chlorophenyl)-1H-pyrazole-5-carboxylic acid
Description:
3-(2-Chlorophenyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a 2-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the second position, contributing to the compound's unique reactivity and potential biological activity. The carboxylic acid functional group at the 5-position of the pyrazole ring enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the presence of the chlorine atom can influence the compound's lipophilicity and metabolic stability. Overall, 3-(2-chlorophenyl)-1H-pyrazole-5-carboxylic acid is a versatile compound with potential implications in drug development and chemical synthesis.
Formula:C10H7ClN2O2
InChI:InChI=1/C10H7ClN2O2/c11-7-4-2-1-3-6(7)8-5-9(10(14)15)13-12-8/h1-5H,(H,12,13)(H,14,15)
SMILES:c1ccc(c(c1)c1cc(C(=O)O)n[nH]1)Cl
Synonyms:- 1H-pyrazole-3-carboxylic acid, 5-(2-chlorophenyl)-
- 1H-Pyrazole-5-carboxylic acid, 3-(2-chlorophenyl)-
- 5-(2-Chlorophenyl)-1H-pyrazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
