CymitQuimica logo

CAS 890621-48-4

:

3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid

Description:
3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a benzodioxole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may form salts or esters. Its molecular structure may contribute to interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid represents a versatile scaffold for further chemical modifications and potential applications in pharmaceuticals or agrochemicals.
Formula:C11H8N2O4
InChI:InChI=1/C11H8N2O4/c14-11(15)8-4-7(12-13-8)6-1-2-9-10(3-6)17-5-16-9/h1-4H,5H2,(H,12,13)(H,14,15)
SMILES:c1cc2c(cc1c1cc(C(=O)O)n[nH]1)OCO2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-(1,3-benzodioxol-5-yl)-
  • 1H-pyrazole-5-carboxylic acid, 3-(1,3-benzodioxol-5-yl)-
  • 5-(1,3-Benzodioxol-5-yl)-1H-pyrazole-3-carboxylic acid
  • Acide 5-(1,3-benzodioxol-5-yl)-1H-pyrazole-3-carboxylique
  • 3-(1,3-Benzodioxol-5-yl)-1H-pyrazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.