CAS 890626-54-7
:1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carbaldehyde
Description:
1-(4-Fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, contributing to the compound's electronic properties and potentially influencing its reactivity and biological activity. The dimethyl groups at the 3 and 5 positions of the pyrazole ring enhance steric hindrance and may affect the compound's solubility and interaction with biological targets. The aldehyde functional group (-CHO) at the 4 position of the pyrazole ring is reactive and can participate in various chemical reactions, such as condensation and oxidation. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could lead to the development of novel pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.
Formula:C12H11FN2O
InChI:InChI=1/C12H11FN2O/c1-8-12(7-16)9(2)15(14-8)11-5-3-10(13)4-6-11/h3-7H,1-2H3
SMILES:Cc1c(C=O)c(C)n(c2ccc(cc2)F)n1
Synonyms:- 1H-pyrazole-4-carboxaldehyde, 1-(4-fluorophenyl)-3,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-FLUOROPHENYL)-3,5-DIMETHYL-1H-PYRAZOLE-4-CARBALDEHYDE
CAS:Formula:C12H11FN2OMolecular weight:218.2269
