CAS 890641-01-7

2-[(5-hydroxy-4,6-dimethylpyrimidin-2-yl)sulfanyl]acetamide

Description:

2-[(5-hydroxy-4,6-dimethylpyrimidin-2-yl)sulfanyl]acetamide, with the CAS number 890641-01-7, is a chemical compound characterized by its unique structure that includes a pyrimidine ring substituted with hydroxyl and methyl groups, as well as a sulfanyl (thioether) group linked to an acetamide moiety. This compound exhibits properties typical of both amides and thioethers, which may influence its solubility and reactivity. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can enhance its solubility in polar solvents. Additionally, the methyl groups on the pyrimidine ring may contribute to its lipophilicity, affecting its biological activity and interaction with cellular targets. The compound may be of interest in pharmaceutical research due to its structural features, which could confer specific biological activities or therapeutic potential. Overall, its unique combination of functional groups positions it as a candidate for further investigation in medicinal chemistry and related fields.

Formula: C₈H₁₁N₃O₂S

InChI: InChI=1/C8H11N3O2S/c1-4-7(13)5(2)11-8(10-4)14-3-6(9)12/h13H,3H2,1-2H3,(H2,9,12)

SMILES: Cc1c(c(C)nc(n1)SCC(=N)O)O

2-((5-Hydroxy-4,6-dimethylpyrimidin-2-yl)thio)acetamide

CAS: 890641-01-7

Formula: C₈H₁₁N₃O₂S

Molecular weight: 213.2568

Ref: IN-DA0087KF

2-[(5-hydroxy-4,6-dimethyl-2-pyrimidinyl)thio]acetamide

CAS: 890641-01-7

Formula: C₈H₁₁N₃O₂S

Purity: 95.0%

Molecular weight: 213.26

Ref: 10-F315662