CymitQuimica logo

CAS 890647-52-6

:

2-[2-[(4-Methylphenyl)thio]ethyl]piperidine

Description:
2-[2-[(4-Methylphenyl)thio]ethyl]piperidine, identified by its CAS number 890647-52-6, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated heterocyclic compound containing one nitrogen atom. The presence of a thioether group, specifically a 4-methylphenylthio moiety, contributes to its unique chemical properties and potential biological activity. The compound is characterized by its moderate lipophilicity, which may influence its solubility in organic solvents and its interaction with biological membranes. Additionally, the presence of the methyl group on the phenyl ring can affect its steric and electronic properties, potentially impacting its reactivity and interactions with other molecules. While specific data on its toxicity and pharmacological effects may not be widely available, compounds of this nature are often investigated for their potential applications in medicinal chemistry and drug development. As with any chemical substance, proper handling and safety precautions are essential due to the potential for hazardous effects.
Formula:C14H21NS
InChI:InChI=1S/C14H21NS/c1-12-5-7-14(8-6-12)16-11-9-13-4-2-3-10-15-13/h5-8,13,15H,2-4,9-11H2,1H3
InChI key:InChIKey=AYLKNALSMUVGAE-UHFFFAOYSA-N
SMILES:S(CCC1CCCCN1)C2=CC=C(C)C=C2
Synonyms:
  • 2-[2-[(4-Methylphenyl)thio]ethyl]piperidine
  • Piperidine, 2-[2-[(4-methylphenyl)thio]ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.