CAS 89069-95-4

N-[[[2-Chloro-5-(trifluoromethyl)phenyl]amino]thioxomethyl]benzamide

Description:

N-[[[2-Chloro-5-(trifluoromethyl)phenyl]amino]thioxomethyl]benzamide, with the CAS number 89069-95-4, is a chemical compound characterized by its complex structure, which includes a benzamide moiety and a thioxomethyl group. This compound features a chloro substituent and a trifluoromethyl group on the phenyl ring, contributing to its unique chemical properties. The presence of the thioxomethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The trifluoromethyl group is known for imparting lipophilicity and enhancing metabolic stability, which can be advantageous in pharmaceutical applications. Additionally, the chlorine atom can influence the compound's electronic properties and reactivity. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. However, specific safety and handling guidelines should be followed due to the presence of halogenated and sulfur-containing groups, which may pose environmental and health risks.

Formula: C₁₅H₁₀ClF₃N₂OS

InChI: InChI=1S/C15H10ClF3N2OS/c16-11-7-6-10(15(17,18)19)8-12(11)20-14(23)21-13(22)9-4-2-1-3-5-9/h1-8H,(H2,20,21,22,23)

InChI key: InChIKey=VIBXULIECXHSSF-UHFFFAOYSA-N

SMILES: N(C(NC(=O)C1=CC=CC=C1)=S)C2=CC(C(F)(F)F)=CC=C2Cl

Synonyms:

• 1-Benzoyl-3-(2-chloro-5-trifluoromethyl-phenyl)-thiourea
• N-[[[2-Chloro-5-(trifluoromethyl)phenyl]amino]thioxomethyl]benzamide
• Benzamide, N-[[[2-chloro-5-(trifluoromethyl)phenyl]amino]thioxomethyl]-

Benzamide, N-[[[2-chloro-5-(trifluoromethyl)phenyl]amino]thioxomethyl]-

CAS: 89069-95-4

Formula: C₁₅H₁₀ClF₃N₂OS

Molecular weight: 358.7659

Ref: IN-DA0040AP