CymitQuimica logo

CAS 890708-64-2

:

2-Methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]benzenesulfonic acid

Description:
2-Methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]benzenesulfonic acid, with CAS number 890708-64-2, is a chemical compound characterized by its complex structure, which includes a methoxy group, a sulfonic acid group, and an amino side chain. This compound is typically classified as an organic sulfonic acid, which contributes to its solubility in water and potential applications in various chemical reactions. The presence of the phenylethylamine moiety suggests that it may exhibit biological activity, possibly interacting with neurotransmitter systems. Its stereochemistry, indicated by the (2R) and (1R) designations, implies specific spatial arrangements that can influence its pharmacological properties. The sulfonic acid group enhances its acidity, making it a strong acid compared to other organic compounds. Overall, this compound's unique structural features may render it useful in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C18H23NO4S
InChI:InChI=1S/C18H23NO4S/c1-13(19-14(2)16-7-5-4-6-8-16)11-15-9-10-17(23-3)18(12-15)24(20,21)22/h4-10,12-14,19H,11H2,1-3H3,(H,20,21,22)/t13-,14-/m1/s1
InChI key:InChIKey=QBGOTFZYXLKICE-ZIAGYGMSSA-N
SMILES:S(=O)(=O)(O)C1=C(OC)C=CC(C[C@H](N[C@H](C)C2=CC=CC=C2)C)=C1
Synonyms:
  • Benzenesulfonic acid, 2-methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]-
  • 2-Methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]benzenesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.