CAS 89073-60-9
:6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione
Description:
6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione, with CAS number 89073-60-9, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with an amino group, two ethyl groups, and a nitroso group, contributing to its unique reactivity and properties. It is characterized by its potential as a bioactive molecule, often studied for its pharmacological applications. The presence of the nitroso group may impart specific reactivity, making it of interest in various chemical reactions, including those involving nitrosation. The compound's structure suggests it may exhibit both hydrophilic and lipophilic characteristics, depending on the solvent environment, which can influence its solubility and interaction with biological systems. Additionally, the presence of multiple functional groups allows for potential derivatization, making it a versatile compound in synthetic organic chemistry. Safety and handling precautions should be observed, as with many nitrogen-containing compounds, due to potential toxicity or reactivity.
Formula:C8H12N4O3
InChI:InChI=1/C8H12N4O3/c1-3-11-6(9)5(10-15)7(13)12(4-2)8(11)14/h3-4,9H2,1-2H3
SMILES:CCn1c(c(c(=O)n(CC)c1=O)N=O)N
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 6-amino-1,3-diethyl-5-nitroso-
- Uracil, 6-amino-1,3-diethyl-5-nitroso-
- 1,3-Diethyl-5-nitroso-6-aminouracil
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
6-AMino-1,3-diethyl-5-nitrosopyriMidine-2,4(1H,3H)-dione
CAS:Formula:C8H12N4O3Color and Shape:SolidMolecular weight:212.20591,3-Diethyl-5-nitroso-6-aminouracil
CAS:Controlled ProductApplications 1,3-Diethyl-5-nitroso-6-aminouracil (cas# 89073-60-9) is a compound useful in organic synthesis.
Formula:C8H12N4O3Color and Shape:NeatMolecular weight:212.21



