CAS 89076-28-8
:[4-(Difluoromethoxy)phenyl](4-fluorophenyl)methanone
Description:
[4-(Difluoromethoxy)phenyl](4-fluorophenyl)methanone, with the CAS number 89076-28-8, is an organic compound characterized by its complex structure featuring a phenyl ring substituted with both difluoromethoxy and fluorophenyl groups. This compound typically exhibits properties associated with aromatic ketones, including a relatively high melting point and solubility in organic solvents. The presence of fluorine atoms in its structure often imparts unique electronic properties, enhancing its reactivity and potential applications in pharmaceuticals and agrochemicals. The difluoromethoxy group can influence the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, the unique combination of functional groups in [4-(Difluoromethoxy)phenyl](4-fluorophenyl)methanone contributes to its potential utility in various chemical applications.
Formula:C14H9F3O2
InChI:InChI=1/C14H9F3O2/c15-11-5-1-9(2-6-11)13(18)10-3-7-12(8-4-10)19-14(16)17/h1-8,14H
InChI key:InChIKey=FNQGQZGRDMENSW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OC(F)F)C=C1)C2=CC=C(F)C=C2
Synonyms:- Methanone, [4-(difluoromethoxy)phenyl](4-fluorophenyl)-
- [4-(Difluoromethoxy)Phenyl](4-Fluorophenyl)Methanone
- 4-Difluoromethoxy-4'-fluorobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methanone,[4-(difluoromethoxy)phenyl](4-fluorophenyl)-
CAS:Formula:C14H9F3O2Molecular weight:266.2153
