CAS 890764-08-6
:1-(2-Fluorophenyl)-3-phenyl-1H-pyrazol-5-amine
Description:
1-(2-Fluorophenyl)-3-phenyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 2-fluorophenyl group and a phenyl group enhances its structural complexity and may influence its chemical reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological targets due to its amine functional group. The fluorine atom can impart unique electronic properties, potentially affecting the compound's lipophilicity and reactivity. As a pyrazole derivative, it may exhibit various pharmacological activities, making it of interest in medicinal chemistry. The compound's CAS number, 890764-08-6, allows for its identification in chemical databases, facilitating research and development in various applications, including drug discovery and material science. Overall, the characteristics of this compound suggest it may have significant utility in both academic and industrial settings.
Formula:C15H12FN3
InChI:InChI=1S/C15H12FN3/c16-12-8-4-5-9-14(12)19-15(17)10-13(18-19)11-6-2-1-3-7-11/h1-10H,17H2
InChI key:InChIKey=VMASRFMJSGJXEG-UHFFFAOYSA-N
SMILES:NC=1N(N=C(C1)C2=CC=CC=C2)C3=C(F)C=CC=C3
Synonyms:- 1H-Pyrazol-5-amine, 1-(2-fluorophenyl)-3-phenyl-
- 1-(2-Fluorophenyl)-3-phenyl-1H-pyrazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.