CymitQuimica logo

CAS 89082-07-5

:

1-(4-Methoxyphenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone

Description:
1-(4-Methoxyphenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone, with the CAS number 89082-07-5, is an organic compound characterized by its unique structural features. It contains a methoxy group attached to a phenyl ring, which contributes to its aromatic properties and potential for various chemical interactions. The presence of a triazole ring, a five-membered heterocyclic compound containing three nitrogen atoms, suggests that this substance may exhibit biological activity, particularly in pharmaceutical applications. The ethanone functional group indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic additions. This compound may be of interest in medicinal chemistry due to its potential as a scaffold for drug development, particularly in the search for antifungal or antimicrobial agents. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, making it essential to consider these factors in practical applications. Overall, this compound represents a blend of aromatic and heterocyclic chemistry, with potential implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H11N3O2
InChI:InChI=1S/C11H11N3O2/c1-16-10-4-2-9(3-5-10)11(15)6-14-8-12-7-13-14/h2-5,7-8H,6H2,1H3
InChI key:InChIKey=VIEZOAOPEPPATJ-UHFFFAOYSA-N
SMILES:C(CN1C=NC=N1)(=O)C2=CC=C(OC)C=C2
Synonyms:
  • 1-(4-Methoxyphenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one
  • 1-(4-Methoxyphenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone
  • Ethanone, 1-(4-methoxyphenyl)-2-(1H-1,2,4-triazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.