
CAS 890839-19-7
:Benzoic acid, 4-borono-2-(dimethylamino)-
Description:
Benzoic acid, 4-borono-2-(dimethylamino)-, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a boronic acid group and a dimethylamino group. The structure features a benzene ring with a carboxylic acid (-COOH) functional group, which contributes to its acidic properties. The boron atom in the boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making this compound potentially useful in various applications, including organic synthesis and medicinal chemistry. The dimethylamino group (-N(CH3)2) enhances the compound's basicity and can influence its solubility and reactivity. This compound may exhibit unique properties due to the interplay between its acidic, basic, and boron-containing functionalities, making it of interest in fields such as drug development and materials science. Its CAS number, 890839-19-7, allows for easy identification and reference in chemical databases and literature.
Formula:C9H12BNO4
InChI:InChI=1S/C9H12BNO4/c1-11(2)8-5-6(10(14)15)3-4-7(8)9(12)13/h3-5,14-15H,1-2H3,(H,12,13)
InChI key:InChIKey=WEDMABGHHXYJDE-UHFFFAOYSA-N
SMILES:N(C)(C)C1=C(C(O)=O)C=CC(B(O)O)=C1
Synonyms:- Benzoic acid, 4-borono-2-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.