CAS 890840-90-1

7,8-difluorochroman-4-one

Description:

7,8-Difluorochroman-4-one is a synthetic organic compound characterized by its chroman structure, which consists of a fused benzene and tetrahydrofuran ring. The presence of two fluorine atoms at the 7 and 8 positions of the chroman ring significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a carbonyl functional group at the 4-position, contributing to its potential as a diketone. The fluorine substituents can enhance the compound's lipophilicity and alter its electronic properties, making it of interest in medicinal chemistry and material science. 7,8-Difluorochroman-4-one may also exhibit interesting biological activities, which can be explored for pharmaceutical applications. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. As with many fluorinated compounds, it may also display unique solubility characteristics and stability under different conditions. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated organic compounds.

Formula: C₉H₆F₂O₂

InChI: InChI=1/C9H6F2O2/c10-6-2-1-5-7(12)3-4-13-9(5)8(6)11/h1-2H,3-4H2

SMILES: c1cc(c(c2c1C(=O)CCO2)F)F

Synonyms:

• 4H-1-benzopyran-4-one, 7,8-difluoro-2,3-dihydro-
• 7,8-Difluoro-2,3-dihydro-4H-chromen-4-one

7,8-Difluorochroman-4-one

CAS: 890840-90-1

Formula: C₉H₆F₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.1395

Ref: IN-DA00369V

7,8-Difluorochroman-4-one

CAS: 890840-90-1

7,8-Difluorochroman-4-one

Purity: 97%

Color and Shape: Pale Yellow Solid

Molecular weight: 184.14g/mol

Ref: 54-PC909653

7,8-Difluorochroman-4-one

CAS: 890840-90-1

Formula: C₉H₆F₂O₂

Purity: 97%

Molecular weight: 184.142

Ref: 10-F216464