CAS 89088-58-4

5H-Pyrazolo[3,4-d]-1,2,3-dithiazol-2-ium, 5-methyl-, chloride

Description:

5H-Pyrazolo[3,4-d]-1,2,3-dithiazol-2-ium, 5-methyl-, chloride is a heterocyclic compound characterized by its unique structure, which includes a pyrazole ring fused to a dithiazole moiety. This compound features a positively charged nitrogen atom in the pyrazole ring, contributing to its ionic nature. The presence of the methyl group at the 5-position of the pyrazole ring influences its solubility and reactivity. As a chloride salt, it typically exists as a stable crystalline solid at room temperature. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and electronic properties. Its synthesis often involves multi-step reactions, and it may exhibit interesting photophysical properties. Additionally, the compound's reactivity can be influenced by the presence of the chloride ion, which may participate in further chemical transformations. Overall, 5H-Pyrazolo[3,4-d]-1,2,3-dithiazol-2-ium, 5-methyl-, chloride is a notable example of a functionalized heterocyclic compound with diverse applications.

Formula: C₄H₄N₃S₂·Cl

InChI: InChI=1S/C4H4N3S2.ClH/c1-7-2-3-4(5-7)6-9-8-3;/h2H,1H3;1H/q+1;/p-1

InChI key: InChIKey=MEBNGDASJOIYOS-UHFFFAOYSA-M

SMILES: CN1C=C2C(=N1)N=[S+]S2.[Cl-]

Synonyms:

• 5H-Pyrazolo[3,4-d]-1,2,3-dithiazol-2-ium, 5-methyl-, chloride

5H-Pyrazolo[3,4-d]-1,2,3-dithiazol-2-ium, 5-methyl-, chloride

CAS: 89088-58-4

Formula: C₄H₄ClN₃S₂

Molecular weight: 193.6777

Ref: IN-DA003Z1Y