CAS 89089-31-6
:3-bromo-2-methylprop-2-en-1-ol
Description:
3-Bromo-2-methylprop-2-en-1-ol, with the CAS number 89089-31-6, is an organic compound characterized by its structure, which features a bromine atom, a double bond, and a hydroxyl group. This compound is classified as an allylic alcohol due to the presence of the hydroxyl (-OH) group adjacent to a carbon-carbon double bond. It typically appears as a colorless to pale yellow liquid and is soluble in polar solvents like water and alcohols, owing to its hydroxyl group. The presence of the bromine atom introduces reactivity, making it a potential intermediate in various organic synthesis reactions, including nucleophilic substitutions and eliminations. Its unique structure allows for the possibility of stereoisomerism, which can influence its chemical behavior and interactions. Additionally, 3-bromo-2-methylprop-2-en-1-ol may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Safety precautions should be taken when handling this compound, as it may pose health risks due to its bromine content and potential reactivity.
Formula:C4H7BrO
InChI:InChI=1/C4H7BrO/c1-4(2-5)3-6/h2,6H,3H2,1H3
SMILES:CC(=CBr)CO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Bromo-2-methyl-2-propen-1-ol(E/Z Mixture)
CAS:Controlled ProductFormula:C4H7BrOColor and Shape:NeatMolecular weight:151.002

