CAS 89092-38-6

4-[2-(4-Aminophenyl)diazenyl]-N-(4-butylphenyl)benzamide

Description:

4-[2-(4-Aminophenyl)diazenyl]-N-(4-butylphenyl)benzamide, also known by its CAS number 89092-38-6, is an organic compound characterized by its azo structure, which features a diazo group (-N=N-) linking two aromatic systems. This compound typically exhibits a deep color due to the presence of the azo group, which is common in azo dyes. It has a molecular structure that includes an amide functional group, contributing to its potential solubility in polar solvents. The presence of both an amino group and a butyl substituent on the phenyl rings suggests that it may have interesting electronic properties and could participate in various chemical reactions, such as azo coupling or electrophilic substitution. Additionally, the compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry or dye synthesis. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents.

Formula: C₂₃H₂₄N₄O

InChI: InChI=1S/C23H24N4O/c1-2-3-4-17-5-11-20(12-6-17)25-23(28)18-7-13-21(14-8-18)26-27-22-15-9-19(24)10-16-22/h5-16H,2-4,24H2,1H3,(H,25,28)

InChI key: InChIKey=DTXGQIUCABOGPB-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(CCCC)C=C1)(=O)C2=CC=C(N=NC3=CC=C(N)C=C3)C=C2

Synonyms:

• Benzamide, 4-[2-(4-aminophenyl)diazenyl]-N-(4-butylphenyl)-
• Benzamide, 4-[(4-aminophenyl)azo]-N-(4-butylphenyl)-
• 4-[2-(4-Aminophenyl)diazenyl]-N-(4-butylphenyl)benzamide

Benzamide, 4-[(4-aminophenyl)azo]-N-(4-butylphenyl)-

CAS: 89092-38-6

Formula: C₂₃H₂₄N₄O

Molecular weight: 372.4629

Ref: IN-DA003ZZ7