CAS 890928-81-1

(13α,14β,17α,20S,24S)-24,25-Epoxylanost-7-ene-3,23-dione

Description:

The chemical substance known as "(13α,14β,17α,20S,24S)-24,25-Epoxylanost-7-ene-3,23-dione," with the CAS number 890928-81-1, is a steroid derivative characterized by its unique epoxide structure and specific stereochemistry. This compound features a lanostane backbone, which is a tetracyclic triterpene structure commonly found in various natural products. The presence of the epoxide functional group at the 24 and 25 positions contributes to its reactivity and potential biological activity. The dione functional groups at the 3 and 23 positions indicate that it has two carbonyl groups, which can participate in various chemical reactions, including nucleophilic attacks. The stereochemistry, denoted by the specific alpha and beta designations, suggests that the compound may exhibit distinct spatial arrangements that influence its interactions with biological targets. Such compounds are often studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities, making them of interest in medicinal chemistry and natural product research.

Formula: C₃₀H₄₆O₃

InChI: InChI=1S/C30H46O3/c1-18(17-22(31)25-27(4,5)33-25)19-11-15-30(8)21-9-10-23-26(2,3)24(32)13-14-28(23,6)20(21)12-16-29(19,30)7/h9,18-20,23,25H,10-17H2,1-8H3/t18-,19-,20-,23-,25+,28+,29-,30+/m0/s1

InChI key: InChIKey=LLEVBDQGRCWBIO-SBRRLATOSA-N

SMILES: C[C@@]12C=3[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])(CC[C@@]1(C)[C@]([C@H](CC(=O)[C@@H]5C(C)(C)O5)C)(CC2)[H])[H]

Synonyms:

• Lanost-7-ene-3,23-dione, 24,25-epoxy-, (13α,14β,17α,20S,24S)-
• (13α,14β,17α,20S,24S)-24,25-Epoxylanost-7-ene-3,23-dione
• 24,25-Epoxytirucall-7-ene-3,23-dione

24,25-Epoxytirucall-7-en-3,23-dione

CAS: 890928-81-1

24,25-Epoxytirucall-7-en-3,23-dione is a natural product for research related to life sciences. The catalog number is TN2819 and the CAS number is 890928-81-1.

Formula: C₃₀H₄₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 454.695

Ref: TM-TN2819

24,25-Epoxytirucall-7-en-3,23-dione

CAS: 890928-81-1

Formula: C₃₀H₄₆O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 454.695

Ref: BP-SBP01406

24,25-Epoxytirucall-7-en-3,23-dione

CAS: 890928-81-1

24,25-Epoxytirucall-7-en-3,23-dione is a triterpenoid compound, which is typically derived from plant sources such as those belonging to the Sapotaceae family. This compound is interesting for its structural complexity and potential bioactive properties. It is isolated through methods like solvent extraction, followed by purification techniques such as chromatography.

Formula: C₃₀H₄₆O₃

Purity: Min. 95%

Molecular weight: 454.7 g/mol

Ref: 3D-QKB92881