CAS 890982-09-9

[4-(propanoylamino)phenoxy]acetic acid

Description:

[4-(Propanoylamino)phenoxy]acetic acid, with the CAS number 890982-09-9, is an organic compound characterized by its unique functional groups and structure. It features a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and an acetic acid moiety, indicating its acidic properties. The presence of the propanoylamino group suggests that it contains an amide linkage, contributing to its potential biological activity. This compound is likely to exhibit solubility in polar solvents due to the presence of the carboxylic acid group, while its aromatic structure may impart some hydrophobic characteristics. The compound may participate in hydrogen bonding due to the amine and carboxylic acid functionalities, influencing its reactivity and interactions with other molecules. Its specific applications could range from pharmaceutical development to biochemical research, depending on its biological activity and interaction with various biological targets. Overall, [4-(propanoylamino)phenoxy]acetic acid represents a versatile structure with potential significance in medicinal chemistry.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1/C11H13NO4/c1-2-10(13)12-8-3-5-9(6-4-8)16-7-11(14)15/h3-6H,2,7H2,1H3,(H,12,13)(H,14,15)

SMILES: CCC(=O)Nc1ccc(cc1)OCC(=O)O

Synonyms:

• [4-(Propionylamino)phenoxy]acetic acid
• Acetic Acid, 2-[4-[(1-Oxopropyl)Amino]Phenoxy]-

[4-(propionylamino)phenoxy]acetic acid

CAS: 890982-09-9

Formula: C₁₁H₁₃NO₄

Purity: 95.0%

Molecular weight: 223.228

Ref: 10-F315703