CAS 890982-57-7

5-methyl-2-[(2-methylpropanoyl)amino]benzoic acid

Description:

5-Methyl-2-[(2-methylpropanoyl)amino]benzoic acid, with the CAS number 890982-57-7, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and an amide functional group. The presence of the 2-methylpropanoyl group indicates that it has a branched alkyl chain, contributing to its hydrophobic characteristics. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic regions. The carboxylic acid functional group provides acidic properties, allowing it to participate in acid-base reactions. Additionally, the amide linkage suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Overall, this compound may have applications in pharmaceuticals or as a biochemical probe, given its structural features that could interact with biological systems. Further studies would be necessary to explore its specific properties, reactivity, and potential applications in various fields.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1/C12H15NO3/c1-7(2)11(14)13-10-5-4-8(3)6-9(10)12(15)16/h4-7H,1-3H3,(H,13,14)(H,15,16)

SMILES: CC(C)C(=Nc1ccc(C)cc1C(=O)O)O

Synonyms:

• 2-(Isobutyrylamino)-5-methylbenzoic acid
• Benzoic Acid, 5-Methyl-2-[(2-Methyl-1-Oxopropyl)Amino]-

2-(isobutyrylamino)-5-methylbenzoic acid

CAS: 890982-57-7

Formula: C₁₂H₁₅NO₃

Molecular weight: 221.2524

Ref: IN-DA0040EU