CAS 890984-30-2

[3-(propanoylamino)phenoxy]acetic acid

Description:

[3-(Propanoylamino)phenoxy]acetic acid, with the CAS number 890984-30-2, is a chemical compound that features both an aromatic and an aliphatic structure. It contains a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and an acetic acid moiety, indicating its potential as a carboxylic acid. The presence of the propanoylamino group suggests that it has an amide functional group, which can influence its solubility and reactivity. This compound may exhibit properties typical of both acids and amides, such as the ability to form hydrogen bonds, which can affect its interactions in biological systems. Its structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often important for biological activity. Additionally, the compound's characteristics, including its melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, [3-(propanoylamino)phenoxy]acetic acid is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1/C11H13NO4/c1-2-10(13)12-8-4-3-5-9(6-8)16-7-11(14)15/h3-6H,2,7H2,1H3,(H,12,13)(H,14,15)

SMILES: CCC(=Nc1cccc(c1)OCC(=O)O)O

Synonyms:

• [3-(Propionylamino)phenoxy]acetic acid
• Acetic Acid, 2-[3-[(1-Oxopropyl)Amino]Phenoxy]-

[3-(propionylamino)phenoxy]acetic acid

CAS: 890984-30-2

Formula: C₁₁H₁₃NO₄

Purity: 95.0%

Molecular weight: 223.228

Ref: 10-F315755