CAS 891-35-0

4-amino-N-(4-methoxyphenyl)benzamide

Description:

4-Amino-N-(4-methoxyphenyl)benzamide, with the CAS number 891-35-0, is an organic compound characterized by its amide functional group and the presence of both an amino group and a methoxy-substituted phenyl group. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure features a benzene ring with an amino group (-NH2) and a methoxy group (-OCH3) attached to different aromatic rings, which contributes to its chemical reactivity and potential applications in pharmaceuticals and organic synthesis. The presence of the amino group allows for hydrogen bonding, which can influence its solubility and interaction with biological systems. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, making it of interest in medicinal chemistry for the development of drugs or as a building block in synthetic pathways. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₄H₁₄N₂O₂

InChI: InChI=1/C14H14N2O2/c1-18-13-8-6-12(7-9-13)16-14(17)10-2-4-11(15)5-3-10/h2-9H,15H2,1H3,(H,16,17)

SMILES: COc1ccc(cc1)N=C(c1ccc(cc1)N)O

Synonyms:

• Benzamide, 4-amino-N-(4-methoxyphenyl)-

4-amino-N-(4-methoxyphenyl)benzamide

CAS: 891-35-0

Formula: C₁₄H₁₄N₂O₂

Purity: 97%

Molecular weight: 242.2732

Ref: IN-DA003KRL

4-Amino-N-(4-methoxyphenyl)benzamide

CAS: 891-35-0

4-Amino-N-(4-methoxyphenyl)benzamide

Purity: 95%

Molecular weight: 242.27g/mol

Ref: 54-OR83202

4-Amino-N-(4-methoxy-phenyl)-benzamide

CAS: 891-35-0

Formula: C₁₄H₁₄N₂O₂

Purity: 97.0%

Molecular weight: 242.278

Ref: 10-F344199

4-Amino-n-(4-methoxyphenyl)benzamide

CAS: 891-35-0

4-Amino-N-(4-methoxyphenyl)benzamide is a catalytic sulfamate that has been optimized for use in the synthesis of benzimidazole derivatives. 4-Amino-N-(4-methoxyphenyl)benzamide is used as a reagent for the preparation of aldehydes from sulfamic acid and various types of carboxylic acids. The reaction mechanism involves nucleophilic attack by the hydroxyl group from the sulfamate on the carbonyl carbon atom to form an intermediate, which then reacts with water to release hydrogen sulfate and form a new double bond.

Formula: C₁₄H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 242.27 g/mol

Ref: 3D-AAA89135