CymitQuimica logo

CAS 891-64-5

:

2,2',2''-[1,3,5-triazine-2,4,6-triyltris(oxy)]triacetonitrile

Description:
2,2',2''-[1,3,5-triazine-2,4,6-triyltris(oxy)]triacetonitrile, with CAS number 891-64-5, is a chemical compound characterized by its complex structure, which includes a triazine ring and multiple acetonitrile groups. This compound is typically used in various applications, including as a reagent in organic synthesis and potentially in the field of materials science due to its unique properties. It is known for its stability and ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the triazine moiety contributes to its potential as a ligand in coordination chemistry. Additionally, the compound may exhibit interesting electronic properties, making it a candidate for research in areas such as photochemistry or catalysis. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or environmental impact. Overall, its multifunctional nature makes it a subject of interest in various chemical research domains.
Formula:C9H6N6O3
InChI:InChI=1/C9H6N6O3/c10-1-4-16-7-13-8(17-5-2-11)15-9(14-7)18-6-3-12/h4-6H2
Synonyms:
  • 2,2',2''-[1,3,5-Triazine-2,4,6-triyltris(oxy)]trisacetonitrile
  • 1,3,5-Triazine, 2,4,6-tris(cyanomethoxy)-
  • (4,6-Bis-cyanomethoxy-[1,3,5]triazin-2-yloxy)-acetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.