CAS 89102-79-4

Phosphonic acid, [(2-phenyl-5-oxazolyl)methyl]-, diethyl ester

Description:

Phosphonic acid, [(2-phenyl-5-oxazolyl)methyl]-, diethyl ester, identified by CAS number 89102-79-4, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and two ethyl ester groups. This compound features a phenyl group and an oxazole ring, contributing to its unique chemical properties and potential biological activity. Typically, phosphonic acids exhibit strong acidity due to the presence of the phosphonic acid moiety, which can participate in various chemical reactions, including esterification and hydrolysis. The diethyl ester form enhances its lipophilicity, potentially improving its ability to penetrate biological membranes. Such compounds are often studied for their applications in agriculture as herbicides or fungicides, as well as in medicinal chemistry for their potential therapeutic effects. The stability of the oxazole ring and the overall molecular structure may influence its reactivity and interactions with other chemical species. Overall, this compound exemplifies the diverse chemistry of organophosphorus compounds and their relevance in various scientific fields.

Formula: C₁₄H₁₈NO₄P

InChI: InChI=1S/C14H18NO4P/c1-3-17-20(16,18-4-2)11-13-10-15-14(19-13)12-8-6-5-7-9-12/h5-10H,3-4,11H2,1-2H3

InChI key: InChIKey=CNAWNMRETZLNQE-UHFFFAOYSA-N

SMILES: C(P(OCC)(OCC)=O)C=1OC(=NC1)C2=CC=CC=C2

Synonyms:

• Phosphonic acid, [(2-phenyl-5-oxazolyl)methyl]-, diethyl ester

Phosphonic acid, [(2-phenyl-5-oxazolyl)methyl]-, diethyl ester

CAS: 89102-79-4

Formula: C₁₄H₁₈NO₄P

Molecular weight: 295.2708

Ref: IN-DA003YJJ