CAS 89108-46-3
:N-(4-aminobutyl)-2-naphthalene-*sulfonamide hydro
Description:
N-(4-aminobutyl)-2-naphthalene-sulfonamide hydro, identified by its CAS number 89108-46-3, is a chemical compound that features a naphthalene ring substituted with a sulfonamide group and an aminoalkyl chain. This compound typically exhibits properties associated with sulfonamides, including potential antibacterial activity due to its structural similarity to sulfanilamide, a well-known antibiotic. The presence of the naphthalene moiety may contribute to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The amino group in the butyl chain can participate in hydrogen bonding, enhancing its reactivity and potential biological interactions. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of new drugs targeting bacterial infections or other diseases. However, specific physical and chemical properties such as melting point, solubility, and stability would require empirical data for precise characterization.
Formula:C14H19ClN2O2S
InChI:InChI=1/C14H18N2O2S.ClH/c15-9-3-4-10-16-19(17,18)14-8-7-12-5-1-2-6-13(12)11-14;/h1-2,5-8,11,16H,3-4,9-10,15H2;1H
SMILES:c1ccc2cc(ccc2c1)S(=O)(=O)NCCCCN.Cl
Synonyms:- N-(4-Aminobutyl)-2-naphthalenesulfonamide, Hydrochloride
- W-12, HCl
- 4-[(Naphthalen-2-Ylsulfonyl)Amino]Butan-1-Aminium Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-(4-Aminobutyl)-2-naphthalenesulfonamide Hydrochloride
CAS:Formula:C14H18N2O2S·HClPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:314.83N-(4-Aminobutyl)-2-naphthalenesulfonamide HCl
CAS:Formula:C14H19ClN2O2SPurity:98.0%Color and Shape:SolidMolecular weight:314.8309N-(4-Aminobutyl)-2-naphthalenesulfonamide hydrochloride
CAS:Formula:C14H18N2O2S·HClMolecular weight:314.83N-(4-Aminobutyl)-2-naphthalenesulphonamide hydrochloride
CAS:N-(4-Aminobutyl)-2-naphthalenesulphonamide hydrochloridePurity:≥95%Molecular weight:314.83g/molN-(4-Aminobutyl)-2-naphthalenesulfonamide Hydrochloride
CAS:Controlled ProductApplications N-(4-Aminobutyl)-2-naphthalenesulfonamide Hydrochloride is a calmodulin antagonist that binds calmodulin and inhibits calcium ion calmodulin-regulated activities such as phosphodiesterase activation and myosin light chain kinase (1, 2).
References (1) Hidaka, H., et al.: Tanpakushitsu Kakusan Koso. (1981) 26, 977-93 (2) Lazzaro, M., et al.: Planta (2013) 238, 587-597Formula:C14H18N2O2S·ClHColor and Shape:NeatMolecular weight:314.83





