CymitQuimica logo

CAS 89108-47-4

:

4-Diazo-4H-imidazole

Description:
4-Diazo-4H-imidazole is a chemical compound characterized by its diazo functional group attached to an imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound typically exhibits properties associated with both diazo compounds and imidazole derivatives, such as potential reactivity in various chemical reactions, including coupling reactions and the formation of azo dyes. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the diazo group imparts unique reactivity, allowing for the formation of new chemical bonds under specific conditions. Additionally, 4-Diazo-4H-imidazole may exhibit specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as light and temperature. As with many diazo compounds, safety precautions should be taken due to their potential reactivity and sensitivity.
Formula:C3H2N4
InChI:InChI=1S/C3H2N4/c4-7-3-1-5-2-6-3/h1-2H
InChI key:InChIKey=MMOHXPNJNVCMRT-UHFFFAOYSA-N
SMILES:[N+](=[N-])=C1C=NC=N1
Synonyms:
  • 4-Diazo-4H-imidazole
  • 4H-Imidazole, 4-diazo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.